About 12H-naphtho[1,2-g][1,2]benzoxazine
12H-naphtho[1,2-g][1,2]benzoxazine (PubChem CID 67117305) has the molecular formula C16H11NO
and a molecular weight of 233.27 g/mol. Its IUPAC name is 12H-naphtho[1,2-g][1,2]benzoxazine.
Molecular Properties
| Compound Name | 12H-naphtho[1,2-g][1,2]benzoxazine |
| PubChem CID | 67117305 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 12H-naphtho[1,2-g][1,2]benzoxazine |
| SMILES | C1=NOC2=Cc3ccc4ccccc4c3CC2=C1 |
| InChI | InChI=1S/C16H11NO/c1-2-4-14-11(3-1)5-6-12-10-16-13(9-15(12)14)7-8-17-18-16/h1-8,10H,9H2 |
| InChIKey | VKQAFQHYTKYTON-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 12H-naphtho[1,2-g][1,2]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12H-naphtho[1,2-g][1,2]benzoxazine?
The IUPAC name of 12H-naphtho[1,2-g][1,2]benzoxazine (CID 67117305) is 12H-naphtho[1,2-g][1,2]benzoxazine.
What is the SMILES notation for 12H-naphtho[1,2-g][1,2]benzoxazine?
The canonical SMILES for 12H-naphtho[1,2-g][1,2]benzoxazine is C1=NOC2=Cc3ccc4ccccc4c3CC2=C1.
What is the InChIKey of 12H-naphtho[1,2-g][1,2]benzoxazine?
The InChIKey is VKQAFQHYTKYTON-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO/c1-2-4-14-11(3-1)5-6-12-10-16-13(9-15(12)14)7-8-17-18-16/h1-8,10H,9H2.
What are the key properties of 12H-naphtho[1,2-g][1,2]benzoxazine?
12H-naphtho[1,2-g][1,2]benzoxazine has a molecular weight of 233.27 g/mol, XLogP of 3.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12H-naphtho[1,2-g][1,2]benzoxazine is sourced from PubChem (CID 67117305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).