C20H18FNOS — CID 67117372
[4-(6-fluoro-1-benzothiophen-3-yl)piperidin-1-yl]-phenylmethanone (PubChem CID 67117372) has the molecular formula C20H18FNOS and a molecular weight of 339.44 g/mol. Its IUPAC name is [4-(6-fluoro-1-benzothiophen-3-yl)piperidin-1-yl]-phenylmethanone.
| Compound Name | [4-(6-fluoro-1-benzothiophen-3-yl)piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 67117372 |
| Molecular Formula | C20H18FNOS |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | [4-(6-fluoro-1-benzothiophen-3-yl)piperidin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCC(c2csc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C20H18FNOS/c21-16-6-7-17-18(13-24-19(17)12-16)14-8-10-22(11-9-14)20(23)15-4-2-1-3-5-15/h1-7,12-14H,8-11H2 |
| InChIKey | NBZRVGYPVOFAPE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |