C18H24BNO4 — CID 67117689
[5-[(E)-2-cyclopropylethenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid (PubChem CID 67117689) has the molecular formula C18H24BNO4 and a molecular weight of 329.21 g/mol. Its IUPAC name is [5-[(E)-2-cyclopropylethenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid.
| Compound Name | [5-[(E)-2-cyclopropylethenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 67117689 |
| Molecular Formula | C18H24BNO4 |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | [5-[(E)-2-cyclopropylethenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid |
| SMILES | CC1(C)OB(c2ccc(/C=C/C3CC3)cc2NC(=O)O)OC1(C)C |
| InChI | InChI=1S/C18H24BNO4/c1-17(2)18(3,4)24-19(23-17)14-10-9-13(8-7-12-5-6-12)11-15(14)20-16(21)22/h7-12,20H,5-6H2,1-4H3,(H,21,22)/b8-7+ |
| InChIKey | CLJBJRBHBUUCQD-BQYQJAHWSA-N |
| XLogP | 3.50 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|