C16H23BO4 — CID 67119347
2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoic acid (PubChem CID 67119347) has the molecular formula C16H23BO4 and a molecular weight of 290.17 g/mol. Its IUPAC name is 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoic acid.
| Compound Name | 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 67119347 |
| Molecular Formula | C16H23BO4 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoic acid |
| SMILES | Cc1cc(C(C)C(=O)O)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H23BO4/c1-10-9-12(11(2)14(18)19)7-8-13(10)17-20-15(3,4)16(5,6)21-17/h7-9,11H,1-6H3,(H,18,19) |
| InChIKey | HTHRNRBHJCDARZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|