C19H16ClN5O3 — CID 67119643
3-(2H-benzotriazole-5-carbonyl)-6-chlorospiro[1,3-benzoxazine-2,4'-piperidine]-4-one (PubChem CID 67119643) has the molecular formula C19H16ClN5O3 and a molecular weight of 397.82 g/mol. Its IUPAC name is 3-(2H-benzotriazole-5-carbonyl)-6-chlorospiro[1,3-benzoxazine-2,4'-piperidine]-4-one.
| Compound Name | 3-(2H-benzotriazole-5-carbonyl)-6-chlorospiro[1,3-benzoxazine-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 67119643 |
| Molecular Formula | C19H16ClN5O3 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 3-(2H-benzotriazole-5-carbonyl)-6-chlorospiro[1,3-benzoxazine-2,4'-piperidine]-4-one |
| SMILES | O=C(c1ccc2n[nH]nc2c1)N1C(=O)c2cc(Cl)ccc2OC12CCNCC2 |
| InChI | InChI=1S/C19H16ClN5O3/c20-12-2-4-16-13(10-12)18(27)25(19(28-16)5-7-21-8-6-19)17(26)11-1-3-14-15(9-11)23-24-22-14/h1-4,9-10,21H,5-8H2,(H,22,23,24) |
| InChIKey | ZUOIRSXGIZMVHV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|