About 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole
3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole (PubChem CID 67120047) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole |
| PubChem CID | 67120047 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole |
| SMILES | c1cc(C2=NOCC2)[nH]n1 |
| InChI | InChI=1S/C6H7N3O/c1-3-7-8-5(1)6-2-4-10-9-6/h1,3H,2,4H2,(H,7,8) |
| InChIKey | BFSOKMKSSXDRON-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole?
The IUPAC name of 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole (CID 67120047) is 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole is c1cc(C2=NOCC2)[nH]n1.
What is the InChIKey of 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole?
The InChIKey is BFSOKMKSSXDRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O/c1-3-7-8-5(1)6-2-4-10-9-6/h1,3H,2,4H2,(H,7,8).
What are the key properties of 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole?
3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole has a molecular weight of 137.14 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-pyrazol-5-yl)-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 67120047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).