About N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide
N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide (PubChem CID 67120132) has the molecular formula C13H12N4O2S2
and a molecular weight of 320.40 g/mol. Its IUPAC name is N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide |
| PubChem CID | 67120132 |
| Molecular Formula | C13H12N4O2S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2csc3cnc(N)nc23)c1 |
| InChI | InChI=1S/C13H12N4O2S2/c1-21(18,19)17-9-4-2-3-8(5-9)10-7-20-11-6-15-13(14)16-12(10)11/h2-7,17H,1H3,(H2,14,15,16) |
| InChIKey | PKSUPIFBGFCPFS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide?
The IUPAC name of N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide (CID 67120132) is N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide?
The canonical SMILES for N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide is CS(=O)(=O)Nc1cccc(-c2csc3cnc(N)nc23)c1.
What is the InChIKey of N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide?
The InChIKey is PKSUPIFBGFCPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O2S2/c1-21(18,19)17-9-4-2-3-8(5-9)10-7-20-11-6-15-13(14)16-12(10)11/h2-7,17H,1H3,(H2,14,15,16).
What are the key properties of N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide?
N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide has a molecular weight of 320.40 g/mol, XLogP of 2.31, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-aminothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide is sourced from PubChem (CID 67120132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).