About 2,3-dihydro-1,3-thiazole-4-carboxamide
2,3-dihydro-1,3-thiazole-4-carboxamide (PubChem CID 67120550) has the molecular formula C4H6N2OS
and a molecular weight of 130.17 g/mol. Its IUPAC name is 2,3-dihydro-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2,3-dihydro-1,3-thiazole-4-carboxamide |
| PubChem CID | 67120550 |
| Molecular Formula | C4H6N2OS |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | 2,3-dihydro-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)C1=CSCN1 |
| InChI | InChI=1S/C4H6N2OS/c5-4(7)3-1-8-2-6-3/h1,6H,2H2,(H2,5,7) |
| InChIKey | XTLWRKHVOFEQQU-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,3-thiazole-4-carboxamide?
The IUPAC name of 2,3-dihydro-1,3-thiazole-4-carboxamide (CID 67120550) is 2,3-dihydro-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2,3-dihydro-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2,3-dihydro-1,3-thiazole-4-carboxamide is NC(=O)C1=CSCN1.
What is the InChIKey of 2,3-dihydro-1,3-thiazole-4-carboxamide?
The InChIKey is XTLWRKHVOFEQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2OS/c5-4(7)3-1-8-2-6-3/h1,6H,2H2,(H2,5,7).
What are the key properties of 2,3-dihydro-1,3-thiazole-4-carboxamide?
2,3-dihydro-1,3-thiazole-4-carboxamide has a molecular weight of 130.17 g/mol, XLogP of -0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 67120550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).