About 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide
5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide (PubChem CID 67120735) has the molecular formula C23H26N2O
and a molecular weight of 346.47 g/mol. Its IUPAC name is 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide.
Molecular Properties
| Compound Name | 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide |
| PubChem CID | 67120735 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide |
| SMILES | CN(C)C(=O)CCCCc1ccc(Cc2nccc3ccccc23)cc1 |
| InChI | InChI=1S/C23H26N2O/c1-25(2)23(26)10-6-3-7-18-11-13-19(14-12-18)17-22-21-9-5-4-8-20(21)15-16-24-22/h4-5,8-9,11-16H,3,6-7,10,17H2,1-2H3 |
| InChIKey | XONASISUNIQHEW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide?
The IUPAC name of 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide (CID 67120735) is 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide.
What is the SMILES notation for 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide?
The canonical SMILES for 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide is CN(C)C(=O)CCCCc1ccc(Cc2nccc3ccccc23)cc1.
What is the InChIKey of 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide?
The InChIKey is XONASISUNIQHEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O/c1-25(2)23(26)10-6-3-7-18-11-13-19(14-12-18)17-22-21-9-5-4-8-20(21)15-16-24-22/h4-5,8-9,11-16H,3,6-7,10,17H2,1-2H3.
What are the key properties of 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide?
5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide has a molecular weight of 346.47 g/mol, XLogP of 4.63, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(isoquinolin-1-ylmethyl)phenyl]-N,N-dimethylpentanamide is sourced from PubChem (CID 67120735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).