About 3-hydroxypyran-2-one;iron
3-hydroxypyran-2-one;iron (PubChem CID 67120749) has the molecular formula C5H4FeO3
and a molecular weight of 167.93 g/mol. Its IUPAC name is 3-hydroxypyran-2-one;iron.
Molecular Properties
| Compound Name | 3-hydroxypyran-2-one;iron |
| PubChem CID | 67120749 |
| Molecular Formula | C5H4FeO3 |
| Molecular Weight | 167.93 g/mol |
| Exact Mass | 167.95 |
| IUPAC Name | 3-hydroxypyran-2-one;iron |
| SMILES | O=c1occcc1O.[Fe] |
| InChI | InChI=1S/C5H4O3.Fe/c6-4-2-1-3-8-5(4)7;/h1-3,6H; |
| InChIKey | QQTUBEKQMMRXHC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.93 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypyran-2-one;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypyran-2-one;iron?
The IUPAC name of 3-hydroxypyran-2-one;iron (CID 67120749) is 3-hydroxypyran-2-one;iron.
What is the SMILES notation for 3-hydroxypyran-2-one;iron?
The canonical SMILES for 3-hydroxypyran-2-one;iron is O=c1occcc1O.[Fe].
What is the InChIKey of 3-hydroxypyran-2-one;iron?
The InChIKey is QQTUBEKQMMRXHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O3.Fe/c6-4-2-1-3-8-5(4)7;/h1-3,6H;.
What are the key properties of 3-hydroxypyran-2-one;iron?
3-hydroxypyran-2-one;iron has a molecular weight of 167.93 g/mol, XLogP of 0.34, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypyran-2-one;iron is sourced from PubChem (CID 67120749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).