C35H32FN5O2 — CID 6712078
(17R)-17-ethynyl-3-[[4-fluoro-6-(2-methylbenzo[f]benzimidazol-3-yl)-1,3,5-triazin-2-yl]oxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 6712078) has the molecular formula C35H32FN5O2 and a molecular weight of 573.67 g/mol. Its IUPAC name is (17R)-17-ethynyl-3-[[4-fluoro-6-(2-methylbenzo[f]benzimidazol-3-yl)-1,3,5-triazin-2-yl]oxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (17R)-17-ethynyl-3-[[4-fluoro-6-(2-methylbenzo[f]benzimidazol-3-yl)-1,3,5-triazin-2-yl]oxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 6712078 |
| Molecular Formula | C35H32FN5O2 |
| Molecular Weight | 573.67 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | (17R)-17-ethynyl-3-[[4-fluoro-6-(2-methylbenzo[f]benzimidazol-3-yl)-1,3,5-triazin-2-yl]oxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C#C[C@]1(O)CCC2C3CCc4cc(Oc5nc(F)nc(-n6c(C)nc7cc8ccccc8cc76)n5)ccc4C3CCC21C |
| InChI | InChI=1S/C35H32FN5O2/c1-4-35(42)16-14-28-27-11-9-23-17-24(10-12-25(23)26(27)13-15-34(28,35)3)43-33-39-31(36)38-32(40-33)41-20(2)37-29-18-21-7-5-6-8-22(21)19-30(29)41/h1,5-8,10,12,17-19,26-28,42H,9,11,13-16H2,2-3H3/t26?,27?,28?,34?,35-/m0/s1 |
| InChIKey | WIRGWEFZSGNXMT-FFXZDGJDSA-N |
| XLogP | 6.82 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|