About copper;imidazolidine-2,4-dione
copper;imidazolidine-2,4-dione (PubChem CID 67120841) has the molecular formula C3H4CuN2O2
and a molecular weight of 163.62 g/mol. Its IUPAC name is copper;imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | copper;imidazolidine-2,4-dione |
| PubChem CID | 67120841 |
| Molecular Formula | C3H4CuN2O2 |
| Molecular Weight | 163.62 g/mol |
| Exact Mass | 162.96 |
| IUPAC Name | copper;imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1.[Cu] |
| InChI | InChI=1S/C3H4N2O2.Cu/c6-2-1-4-3(7)5-2;/h1H2,(H2,4,5,6,7); |
| InChIKey | IVUNRWDSUBIGQW-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.62 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze copper;imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;imidazolidine-2,4-dione?
The IUPAC name of copper;imidazolidine-2,4-dione (CID 67120841) is copper;imidazolidine-2,4-dione.
What is the SMILES notation for copper;imidazolidine-2,4-dione?
The canonical SMILES for copper;imidazolidine-2,4-dione is O=C1CNC(=O)N1.[Cu].
What is the InChIKey of copper;imidazolidine-2,4-dione?
The InChIKey is IVUNRWDSUBIGQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2.Cu/c6-2-1-4-3(7)5-2;/h1H2,(H2,4,5,6,7);.
What are the key properties of copper;imidazolidine-2,4-dione?
copper;imidazolidine-2,4-dione has a molecular weight of 163.62 g/mol, XLogP of -1.18, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;imidazolidine-2,4-dione is sourced from PubChem (CID 67120841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).