About 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide
5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 67120909) has the molecular formula C6H8FN3O
and a molecular weight of 157.15 g/mol. Its IUPAC name is 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide |
| PubChem CID | 67120909 |
| Molecular Formula | C6H8FN3O |
| Molecular Weight | 157.15 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | CN(C)C(=O)c1cn[nH]c1F |
| InChI | InChI=1S/C6H8FN3O/c1-10(2)6(11)4-3-8-9-5(4)7/h3H,1-2H3,(H,8,9) |
| InChIKey | FXNBJQAQRAFQFJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.15 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide?
The IUPAC name of 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide (CID 67120909) is 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide?
The canonical SMILES for 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide is CN(C)C(=O)c1cn[nH]c1F.
What is the InChIKey of 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide?
The InChIKey is FXNBJQAQRAFQFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FN3O/c1-10(2)6(11)4-3-8-9-5(4)7/h3H,1-2H3,(H,8,9).
What are the key properties of 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide?
5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide has a molecular weight of 157.15 g/mol, XLogP of 0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N,N-dimethyl-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 67120909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).