C15H19N5O6S — CID 67121405
(1S,5R)-2-[(6-morpholin-4-yl-3-pyridinyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid (PubChem CID 67121405) has the molecular formula C15H19N5O6S and a molecular weight of 397.41 g/mol. Its IUPAC name is (1S,5R)-2-[(6-morpholin-4-yl-3-pyridinyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid.
| Compound Name | (1S,5R)-2-[(6-morpholin-4-yl-3-pyridinyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
|---|---|
| PubChem CID | 67121405 |
| Molecular Formula | C15H19N5O6S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (1S,5R)-2-[(6-morpholin-4-yl-3-pyridinyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
| SMILES | O=C(Nc1ccc(N2CCOCC2)nc1)N1CC[C@@H]2[C@H]1C(=O)N2S(=O)(=O)O |
| InChI | InChI=1S/C15H19N5O6S/c21-14-13-11(20(14)27(23,24)25)3-4-19(13)15(22)17-10-1-2-12(16-9-10)18-5-7-26-8-6-18/h1-2,9,11,13H,3-8H2,(H,17,22)(H,23,24,25)/t11-,13+/m1/s1 |
| InChIKey | GUUXBAPPGFJJTP-YPMHNXCESA-N |
| XLogP | -0.46 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|