C24H28ClN5O — CID 67121672
1-[4-[5-(6-chloro-1H-benzimidazol-2-yl)-2-pyridinyl]piperazin-1-yl]-2-cyclohexylethanone (PubChem CID 67121672) has the molecular formula C24H28ClN5O and a molecular weight of 437.98 g/mol. Its IUPAC name is 1-[4-[5-(6-chloro-1H-benzimidazol-2-yl)-2-pyridinyl]piperazin-1-yl]-2-cyclohexylethanone.
| Compound Name | 1-[4-[5-(6-chloro-1H-benzimidazol-2-yl)-2-pyridinyl]piperazin-1-yl]-2-cyclohexylethanone |
|---|---|
| PubChem CID | 67121672 |
| Molecular Formula | C24H28ClN5O |
| Molecular Weight | 437.98 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 1-[4-[5-(6-chloro-1H-benzimidazol-2-yl)-2-pyridinyl]piperazin-1-yl]-2-cyclohexylethanone |
| SMILES | O=C(CC1CCCCC1)N1CCN(c2ccc(-c3nc4ccc(Cl)cc4[nH]3)cn2)CC1 |
| InChI | InChI=1S/C24H28ClN5O/c25-19-7-8-20-21(15-19)28-24(27-20)18-6-9-22(26-16-18)29-10-12-30(13-11-29)23(31)14-17-4-2-1-3-5-17/h6-9,15-17H,1-5,10-14H2,(H,27,28) |
| InChIKey | XRCPKHMOWJIRME-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |