About 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide
4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide (PubChem CID 67121803) has the molecular formula C21H26O4S
and a molecular weight of 374.50 g/mol. Its IUPAC name is 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide |
| PubChem CID | 67121803 |
| Molecular Formula | C21H26O4S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide |
| SMILES | COCc1cccc(-c2c(C)cc(OC3CCS(=O)(=O)CC3)cc2C)c1 |
| InChI | InChI=1S/C21H26O4S/c1-15-11-20(25-19-7-9-26(22,23)10-8-19)12-16(2)21(15)18-6-4-5-17(13-18)14-24-3/h4-6,11-13,19H,7-10,14H2,1-3H3 |
| InChIKey | XHFCZGHLPAYIMC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide?
The IUPAC name of 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide (CID 67121803) is 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide.
What is the SMILES notation for 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide?
The canonical SMILES for 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide is COCc1cccc(-c2c(C)cc(OC3CCS(=O)(=O)CC3)cc2C)c1.
What is the InChIKey of 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide?
The InChIKey is XHFCZGHLPAYIMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O4S/c1-15-11-20(25-19-7-9-26(22,23)10-8-19)12-16(2)21(15)18-6-4-5-17(13-18)14-24-3/h4-6,11-13,19H,7-10,14H2,1-3H3.
What are the key properties of 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide?
4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide has a molecular weight of 374.50 g/mol, XLogP of 4.07, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[3-(methoxymethyl)phenyl]-3,5-dimethylphenoxy]thiane 1,1-dioxide is sourced from PubChem (CID 67121803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).