C10H12N2O3S — CID 67121822
5-(4-methylphenyl)-1,1-dioxo-1,2,6-thiadiazinan-3-one (PubChem CID 67121822) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 5-(4-methylphenyl)-1,1-dioxo-1,2,6-thiadiazinan-3-one.
| Compound Name | 5-(4-methylphenyl)-1,1-dioxo-1,2,6-thiadiazinan-3-one |
|---|---|
| PubChem CID | 67121822 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 5-(4-methylphenyl)-1,1-dioxo-1,2,6-thiadiazinan-3-one |
| SMILES | Cc1ccc(C2CC(=O)NS(=O)(=O)N2)cc1 |
| InChI | InChI=1S/C10H12N2O3S/c1-7-2-4-8(5-3-7)9-6-10(13)12-16(14,15)11-9/h2-5,9,11H,6H2,1H3,(H,12,13) |
| InChIKey | LYFMRZCJKQVOTO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |