C33H38BNO8 — CID 67121843
2-[4-[[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 67121843) has the molecular formula C33H38BNO8 and a molecular weight of 587.48 g/mol. Its IUPAC name is 2-[4-[[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-[4-[[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 67121843 |
| Molecular Formula | C33H38BNO8 |
| Molecular Weight | 587.48 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | 2-[4-[[3-[4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | Cc1cc(OCC2COC(C)(C)OC2)cc(C)c1-c1cccc(COc2ccc(B3OC(=O)CN(C)CC(=O)O3)cc2)c1 |
| InChI | InChI=1S/C33H38BNO8/c1-22-13-29(39-19-25-20-40-33(3,4)41-21-25)14-23(2)32(22)26-8-6-7-24(15-26)18-38-28-11-9-27(10-12-28)34-42-30(36)16-35(5)17-31(37)43-34/h6-15,25H,16-21H2,1-5H3 |
| InChIKey | PGNBBLUVEAHQCW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|