C28H31N3O7S — CID 67121871
5-[4-[[(1R)-4-[[6-(3-hydroxy-3-methylbutoxy)-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one (PubChem CID 67121871) has the molecular formula C28H31N3O7S and a molecular weight of 553.64 g/mol. Its IUPAC name is 5-[4-[[(1R)-4-[[6-(3-hydroxy-3-methylbutoxy)-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one.
| Compound Name | 5-[4-[[(1R)-4-[[6-(3-hydroxy-3-methylbutoxy)-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one |
|---|---|
| PubChem CID | 67121871 |
| Molecular Formula | C28H31N3O7S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 5-[4-[[(1R)-4-[[6-(3-hydroxy-3-methylbutoxy)-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one |
| SMILES | CC(C)(O)CCOc1ccc(Oc2cccc3c2CC[C@H]3Oc2ccc(C3CC(=O)NS(=O)(=O)N3)cc2)cn1 |
| InChI | InChI=1S/C28H31N3O7S/c1-28(2,33)14-15-36-27-13-10-20(17-29-27)38-24-5-3-4-21-22(24)11-12-25(21)37-19-8-6-18(7-9-19)23-16-26(32)31-39(34,35)30-23/h3-10,13,17,23,25,30,33H,11-12,14-16H2,1-2H3,(H,31,32)/t23?,25-/m1/s1 |
| InChIKey | TZPFBBSLEKSXKB-XSWBTSGESA-N |
| XLogP | 3.88 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |