C29H33N3O7S — CID 67121875
5-[4-[[(1R)-4-[[6-(3-hydroxy-3-methylbutoxy)-2-methyl-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one (PubChem CID 67121875) has the molecular formula C29H33N3O7S and a molecular weight of 567.66 g/mol. Its IUPAC name is 5-[4-[[(1R)-4-[[6-(3-hydroxy-3-methylbutoxy)-2-methyl-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one.
| Compound Name | 5-[4-[[(1R)-4-[[6-(3-hydroxy-3-methylbutoxy)-2-methyl-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one |
|---|---|
| PubChem CID | 67121875 |
| Molecular Formula | C29H33N3O7S |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 5-[4-[[(1R)-4-[[6-(3-hydroxy-3-methylbutoxy)-2-methyl-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one |
| SMILES | Cc1nc(OCCC(C)(C)O)ccc1Oc1cccc2c1CC[C@H]2Oc1ccc(C2CC(=O)NS(=O)(=O)N2)cc1 |
| InChI | InChI=1S/C29H33N3O7S/c1-18-24(13-14-28(30-18)37-16-15-29(2,3)34)39-25-6-4-5-21-22(25)11-12-26(21)38-20-9-7-19(8-10-20)23-17-27(33)32-40(35,36)31-23/h4-10,13-14,23,26,31,34H,11-12,15-17H2,1-3H3,(H,32,33)/t23?,26-/m1/s1 |
| InChIKey | RGCLJYKXQGNJJT-ANWICMFUSA-N |
| XLogP | 4.18 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |