C28H31N3O8S2 — CID 67121876
5-[4-[[(1R)-4-[[2-methyl-6-(3-methylsulfonylpropoxy)-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one (PubChem CID 67121876) has the molecular formula C28H31N3O8S2 and a molecular weight of 601.70 g/mol. Its IUPAC name is 5-[4-[[(1R)-4-[[2-methyl-6-(3-methylsulfonylpropoxy)-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one.
| Compound Name | 5-[4-[[(1R)-4-[[2-methyl-6-(3-methylsulfonylpropoxy)-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one |
|---|---|
| PubChem CID | 67121876 |
| Molecular Formula | C28H31N3O8S2 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | 5-[4-[[(1R)-4-[[2-methyl-6-(3-methylsulfonylpropoxy)-3-pyridinyl]oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,1-dioxo-1,2,6-thiadiazinan-3-one |
| SMILES | Cc1nc(OCCCS(C)(=O)=O)ccc1Oc1cccc2c1CC[C@H]2Oc1ccc(C2CC(=O)NS(=O)(=O)N2)cc1 |
| InChI | InChI=1S/C28H31N3O8S2/c1-18-24(13-14-28(29-18)37-15-4-16-40(2,33)34)39-25-6-3-5-21-22(25)11-12-26(21)38-20-9-7-19(8-10-20)23-17-27(32)31-41(35,36)30-23/h3,5-10,13-14,23,26,30H,4,11-12,15-17H2,1-2H3,(H,31,32)/t23?,26-/m1/s1 |
| InChIKey | WSVFPLJDBHMLQO-ANWICMFUSA-N |
| XLogP | 3.46 |
| TPSA | 149.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|