About 5-methyl-1-oxo-1,2-thiazolidin-3-one
5-methyl-1-oxo-1,2-thiazolidin-3-one (PubChem CID 67121918) has the molecular formula C4H7NO2S
and a molecular weight of 133.17 g/mol. Its IUPAC name is 5-methyl-1-oxo-1,2-thiazolidin-3-one.
Molecular Properties
| Compound Name | 5-methyl-1-oxo-1,2-thiazolidin-3-one |
| PubChem CID | 67121918 |
| Molecular Formula | C4H7NO2S |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.02 |
| IUPAC Name | 5-methyl-1-oxo-1,2-thiazolidin-3-one |
| SMILES | CC1CC(=O)NS1=O |
| InChI | InChI=1S/C4H7NO2S/c1-3-2-4(6)5-8(3)7/h3H,2H2,1H3,(H,5,6) |
| InChIKey | KQVUGOABVSWNKR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-1-oxo-1,2-thiazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-oxo-1,2-thiazolidin-3-one?
The IUPAC name of 5-methyl-1-oxo-1,2-thiazolidin-3-one (CID 67121918) is 5-methyl-1-oxo-1,2-thiazolidin-3-one.
What is the SMILES notation for 5-methyl-1-oxo-1,2-thiazolidin-3-one?
The canonical SMILES for 5-methyl-1-oxo-1,2-thiazolidin-3-one is CC1CC(=O)NS1=O.
What is the InChIKey of 5-methyl-1-oxo-1,2-thiazolidin-3-one?
The InChIKey is KQVUGOABVSWNKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2S/c1-3-2-4(6)5-8(3)7/h3H,2H2,1H3,(H,5,6).
What are the key properties of 5-methyl-1-oxo-1,2-thiazolidin-3-one?
5-methyl-1-oxo-1,2-thiazolidin-3-one has a molecular weight of 133.17 g/mol, XLogP of -0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-oxo-1,2-thiazolidin-3-one is sourced from PubChem (CID 67121918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).