C23H34O3 — CID 6712222
methyl (1S,5R,9R,12R)-5,9-dimethyl-15-oxo-13-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-13-ene-5-carboxylate (PubChem CID 6712222) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is methyl (1S,5R,9R,12R)-5,9-dimethyl-15-oxo-13-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-13-ene-5-carboxylate.
| Compound Name | methyl (1S,5R,9R,12R)-5,9-dimethyl-15-oxo-13-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-13-ene-5-carboxylate |
|---|---|
| PubChem CID | 6712222 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | methyl (1S,5R,9R,12R)-5,9-dimethyl-15-oxo-13-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-13-ene-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)C1CC[C@@]13C=C(C(C)C)[C@@H](CC1=O)CC23 |
| InChI | InChI=1S/C23H34O3/c1-14(2)16-13-23-10-7-17-21(3,18(23)11-15(16)12-19(23)24)8-6-9-22(17,4)20(25)26-5/h13-15,17-18H,6-12H2,1-5H3/t15-,17?,18?,21+,22-,23+/m1/s1 |
| InChIKey | UHJVGDFZCWFEKB-QWLCNCAFSA-N |
| XLogP | 4.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|