C24H36O5 — CID 67122226
(E)-8-methyl-1-[2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,3-dioxolan-2-yl]tetradec-8-en-4,12-diyn-7-ol (PubChem CID 67122226) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is (E)-8-methyl-1-[2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,3-dioxolan-2-yl]tetradec-8-en-4,12-diyn-7-ol.
| Compound Name | (E)-8-methyl-1-[2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,3-dioxolan-2-yl]tetradec-8-en-4,12-diyn-7-ol |
|---|---|
| PubChem CID | 67122226 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (E)-8-methyl-1-[2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,3-dioxolan-2-yl]tetradec-8-en-4,12-diyn-7-ol |
| SMILES | CC#CCC/C=C(\C)C(O)CC#CCCCC1(CCC2(C)OCCO2)OCCO1 |
| InChI | InChI=1S/C24H36O5/c1-4-5-6-9-12-21(2)22(25)13-10-7-8-11-14-24(28-19-20-29-24)16-15-23(3)26-17-18-27-23/h12,22,25H,6,8-9,11,13-20H2,1-3H3/b21-12+ |
| InChIKey | SUVWKIWKXMLLSC-CIAFOILYSA-N |
| XLogP | 3.95 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|