About 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride
1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride (PubChem CID 67122724) has the molecular formula C8H11ClN6O2
and a molecular weight of 258.67 g/mol. Its IUPAC name is 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride.
Molecular Properties
| Compound Name | 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride |
| PubChem CID | 67122724 |
| Molecular Formula | C8H11ClN6O2 |
| Molecular Weight | 258.67 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride |
| SMILES | C/N=C(\N)NCc1[nH]c(=O)[nH]c(=O)c1C#N.Cl |
| InChI | InChI=1S/C8H10N6O2.ClH/c1-11-7(10)12-3-5-4(2-9)6(15)14-8(16)13-5;/h3H2,1H3,(H3,10,11,12)(H2,13,14,15,16);1H |
| InChIKey | LTBVGRIQSIIEDZ-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.67 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride?
The IUPAC name of 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride (CID 67122724) is 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride.
What is the SMILES notation for 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride?
The canonical SMILES for 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride is C/N=C(\N)NCc1[nH]c(=O)[nH]c(=O)c1C#N.Cl.
What is the InChIKey of 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride?
The InChIKey is LTBVGRIQSIIEDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N6O2.ClH/c1-11-7(10)12-3-5-4(2-9)6(15)14-8(16)13-5;/h3H2,1H3,(H3,10,11,12)(H2,13,14,15,16);1H.
What are the key properties of 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride?
1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride has a molecular weight of 258.67 g/mol, XLogP of -1.61, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine;hydrochloride is sourced from PubChem (CID 67122724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).