About 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine
1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine (PubChem CID 67122725) has the molecular formula C8H10N6O2
and a molecular weight of 222.21 g/mol. Its IUPAC name is 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine.
Molecular Properties
| Compound Name | 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine |
| PubChem CID | 67122725 |
| Molecular Formula | C8H10N6O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCc1[nH]c(=O)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C8H10N6O2/c1-11-7(10)12-3-5-4(2-9)6(15)14-8(16)13-5/h3H2,1H3,(H3,10,11,12)(H2,13,14,15,16) |
| InChIKey | QCQRSTKHQDIENO-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine?
The IUPAC name of 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine (CID 67122725) is 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine.
What is the SMILES notation for 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine?
The canonical SMILES for 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine is C/N=C(\N)NCc1[nH]c(=O)[nH]c(=O)c1C#N.
What is the InChIKey of 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine?
The InChIKey is QCQRSTKHQDIENO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N6O2/c1-11-7(10)12-3-5-4(2-9)6(15)14-8(16)13-5/h3H2,1H3,(H3,10,11,12)(H2,13,14,15,16).
What are the key properties of 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine?
1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine has a molecular weight of 222.21 g/mol, XLogP of -2.03, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-cyano-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-2-methylguanidine is sourced from PubChem (CID 67122725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).