About 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine
1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine (PubChem CID 67122766) has the molecular formula C7H10BrN5O2
and a molecular weight of 276.09 g/mol. Its IUPAC name is 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine.
Molecular Properties
| Compound Name | 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine |
| PubChem CID | 67122766 |
| Molecular Formula | C7H10BrN5O2 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine |
| SMILES | [H]/N=C(\N)N(C)Cc1[nH]c(=O)[nH]c(=O)c1Br |
| InChI | InChI=1S/C7H10BrN5O2/c1-13(6(9)10)2-3-4(8)5(14)12-7(15)11-3/h2H2,1H3,(H3,9,10)(H2,11,12,14,15) |
| InChIKey | MZGCYAILYMLGBX-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine?
The IUPAC name of 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine (CID 67122766) is 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine.
What is the SMILES notation for 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine?
The canonical SMILES for 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine is [H]/N=C(\N)N(C)Cc1[nH]c(=O)[nH]c(=O)c1Br.
What is the InChIKey of 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine?
The InChIKey is MZGCYAILYMLGBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrN5O2/c1-13(6(9)10)2-3-4(8)5(14)12-7(15)11-3/h2H2,1H3,(H3,9,10)(H2,11,12,14,15).
What are the key properties of 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine?
1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine has a molecular weight of 276.09 g/mol, XLogP of -0.85, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1-methylguanidine is sourced from PubChem (CID 67122766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).