About 6-but-3-enyl-1,4-dioxecane-5,10-dione
6-but-3-enyl-1,4-dioxecane-5,10-dione (PubChem CID 67122890) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 6-but-3-enyl-1,4-dioxecane-5,10-dione.
Molecular Properties
| Compound Name | 6-but-3-enyl-1,4-dioxecane-5,10-dione |
| PubChem CID | 67122890 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 6-but-3-enyl-1,4-dioxecane-5,10-dione |
| SMILES | C=CCCC1CCCC(=O)OCCOC1=O |
| InChI | InChI=1S/C12H18O4/c1-2-3-5-10-6-4-7-11(13)15-8-9-16-12(10)14/h2,10H,1,3-9H2 |
| InChIKey | VEQSEPJVVSRDAX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-but-3-enyl-1,4-dioxecane-5,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-but-3-enyl-1,4-dioxecane-5,10-dione?
The IUPAC name of 6-but-3-enyl-1,4-dioxecane-5,10-dione (CID 67122890) is 6-but-3-enyl-1,4-dioxecane-5,10-dione.
What is the SMILES notation for 6-but-3-enyl-1,4-dioxecane-5,10-dione?
The canonical SMILES for 6-but-3-enyl-1,4-dioxecane-5,10-dione is C=CCCC1CCCC(=O)OCCOC1=O.
What is the InChIKey of 6-but-3-enyl-1,4-dioxecane-5,10-dione?
The InChIKey is VEQSEPJVVSRDAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-2-3-5-10-6-4-7-11(13)15-8-9-16-12(10)14/h2,10H,1,3-9H2.
What are the key properties of 6-but-3-enyl-1,4-dioxecane-5,10-dione?
6-but-3-enyl-1,4-dioxecane-5,10-dione has a molecular weight of 226.27 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-but-3-enyl-1,4-dioxecane-5,10-dione is sourced from PubChem (CID 67122890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).