About 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid
2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid (PubChem CID 67122966) has the molecular formula C15H18Cl2FNO3
and a molecular weight of 350.22 g/mol. Its IUPAC name is 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid |
| PubChem CID | 67122966 |
| Molecular Formula | C15H18Cl2FNO3 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid |
| SMILES | CCCC1(C(O)c2cc(F)c(Cl)c(Cl)c2)CCCN1C(=O)O |
| InChI | InChI=1S/C15H18Cl2FNO3/c1-2-4-15(5-3-6-19(15)14(21)22)13(20)9-7-10(16)12(17)11(18)8-9/h7-8,13,20H,2-6H2,1H3,(H,21,22) |
| InChIKey | ULPBEEGUYQZARL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid?
The IUPAC name of 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid (CID 67122966) is 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid.
What is the SMILES notation for 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid?
The canonical SMILES for 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid is CCCC1(C(O)c2cc(F)c(Cl)c(Cl)c2)CCCN1C(=O)O.
What is the InChIKey of 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid?
The InChIKey is ULPBEEGUYQZARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18Cl2FNO3/c1-2-4-15(5-3-6-19(15)14(21)22)13(20)9-7-10(16)12(17)11(18)8-9/h7-8,13,20H,2-6H2,1H3,(H,21,22).
What are the key properties of 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid?
2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid has a molecular weight of 350.22 g/mol, XLogP of 4.48, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylic acid is sourced from PubChem (CID 67122966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).