About 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide
2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide (PubChem CID 67123054) has the molecular formula C14H12Br2N2
and a molecular weight of 368.07 g/mol. Its IUPAC name is 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide |
| PubChem CID | 67123054 |
| Molecular Formula | C14H12Br2N2 |
| Molecular Weight | 368.07 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide |
| SMILES | Br.Cc1cccn2cc(-c3ccc(Br)cc3)nc12 |
| InChI | InChI=1S/C14H11BrN2.BrH/c1-10-3-2-8-17-9-13(16-14(10)17)11-4-6-12(15)7-5-11;/h2-9H,1H3;1H |
| InChIKey | MYUMXQBBBHFPFK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.07 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide?
The IUPAC name of 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide (CID 67123054) is 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide.
What is the SMILES notation for 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide?
The canonical SMILES for 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide is Br.Cc1cccn2cc(-c3ccc(Br)cc3)nc12.
What is the InChIKey of 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide?
The InChIKey is MYUMXQBBBHFPFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrN2.BrH/c1-10-3-2-8-17-9-13(16-14(10)17)11-4-6-12(15)7-5-11;/h2-9H,1H3;1H.
What are the key properties of 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide?
2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide has a molecular weight of 368.07 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide is sourced from PubChem (CID 67123054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).