C17H22ClNO — CID 67123078
(3aR,4S,7aR)-1-ethynyl-2,3,3a,4,5,6,7,7a-octahydroindol-4-ol;2-methylbicyclo[2.2.0]hexa-1,3,5-triene;hydrochloride (PubChem CID 67123078) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is (3aR,4S,7aR)-1-ethynyl-2,3,3a,4,5,6,7,7a-octahydroindol-4-ol;2-methylbicyclo[2.2.0]hexa-1,3,5-triene;hydrochloride.
| Compound Name | (3aR,4S,7aR)-1-ethynyl-2,3,3a,4,5,6,7,7a-octahydroindol-4-ol;2-methylbicyclo[2.2.0]hexa-1,3,5-triene;hydrochloride |
|---|---|
| PubChem CID | 67123078 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (3aR,4S,7aR)-1-ethynyl-2,3,3a,4,5,6,7,7a-octahydroindol-4-ol;2-methylbicyclo[2.2.0]hexa-1,3,5-triene;hydrochloride |
| SMILES | C#CN1CC[C@@H]2[C@H]1CCC[C@@H]2O.Cc1cc2ccc1-2.Cl |
| InChI | InChI=1S/C10H15NO.C7H6.ClH/c1-2-11-7-6-8-9(11)4-3-5-10(8)12;1-5-4-6-2-3-7(5)6;/h1,8-10,12H,3-7H2;2-4H,1H3;1H/t8-,9-,10+;;/m1../s1 |
| InChIKey | OZINJOLJRCLEJI-XYSAUEOZSA-N |
| XLogP | 3.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|