C15H29NO5Si — CID 67123094
(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-propylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 67123094) has the molecular formula C15H29NO5Si and a molecular weight of 331.49 g/mol. Its IUPAC name is (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-propylpyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-propylpyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67123094 |
| Molecular Formula | C15H29NO5Si |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-propylpyrrolidine-1,2-dicarboxylic acid |
| SMILES | CCC[C@]1(C(=O)O)C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)O |
| InChI | InChI=1S/C15H29NO5Si/c1-7-8-15(12(17)18)9-11(10-16(15)13(19)20)21-22(5,6)14(2,3)4/h11H,7-10H2,1-6H3,(H,17,18)(H,19,20)/t11-,15-/m1/s1 |
| InChIKey | QGVIGUDQPRSSTI-IAQYHMDHSA-N |
| XLogP | 3.38 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|