About (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane
(6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane (PubChem CID 67123276) has the molecular formula C13H17Cl2NO2
and a molecular weight of 290.19 g/mol. Its IUPAC name is (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane.
Molecular Properties
| Compound Name | (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane |
| PubChem CID | 67123276 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane |
| SMILES | COC[C@@H]1CNCCOC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO2/c1-17-8-10-7-16-4-5-18-13(10)9-2-3-11(14)12(15)6-9/h2-3,6,10,13,16H,4-5,7-8H2,1H3/t10-,13?/m0/s1 |
| InChIKey | TVIJHPWWERHHIP-NKUHCKNESA-N |
| XLogP | 2.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane?
The IUPAC name of (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane (CID 67123276) is (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane.
What is the SMILES notation for (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane?
The canonical SMILES for (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane is COC[C@@H]1CNCCOC1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane?
The InChIKey is TVIJHPWWERHHIP-NKUHCKNESA-N. The full InChI is InChI=1S/C13H17Cl2NO2/c1-17-8-10-7-16-4-5-18-13(10)9-2-3-11(14)12(15)6-9/h2-3,6,10,13,16H,4-5,7-8H2,1H3/t10-,13?/m0/s1.
What are the key properties of (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane?
(6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane has a molecular weight of 290.19 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-7-(3,4-dichlorophenyl)-6-(methoxymethyl)-1,4-oxazepane is sourced from PubChem (CID 67123276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).