About 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane
4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane (PubChem CID 67123286) has the molecular formula C14H21NOS
and a molecular weight of 251.39 g/mol. Its IUPAC name is 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane |
| PubChem CID | 67123286 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane |
| SMILES | CSCC1C(c2ccccc2)COCCN1C |
| InChI | InChI=1S/C14H21NOS/c1-15-8-9-16-10-13(14(15)11-17-2)12-6-4-3-5-7-12/h3-7,13-14H,8-11H2,1-2H3 |
| InChIKey | MWCDDGSKUKCCDT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane?
The IUPAC name of 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane (CID 67123286) is 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane.
What is the SMILES notation for 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane?
The canonical SMILES for 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane is CSCC1C(c2ccccc2)COCCN1C.
What is the InChIKey of 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane?
The InChIKey is MWCDDGSKUKCCDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NOS/c1-15-8-9-16-10-13(14(15)11-17-2)12-6-4-3-5-7-12/h3-7,13-14H,8-11H2,1-2H3.
What are the key properties of 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane?
4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane has a molecular weight of 251.39 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-(methylsulfanylmethyl)-6-phenyl-1,4-oxazepane is sourced from PubChem (CID 67123286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).