C13H15Cl2F3N2O3S — CID 67123364
N-[[(6S,7R)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 67123364) has the molecular formula C13H15Cl2F3N2O3S and a molecular weight of 407.24 g/mol. Its IUPAC name is N-[[(6S,7R)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[[(6S,7R)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 67123364 |
| Molecular Formula | C13H15Cl2F3N2O3S |
| Molecular Weight | 407.24 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | N-[[(6S,7R)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NC[C@@H]1CNCCO[C@H]1c1ccc(Cl)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C13H15Cl2F3N2O3S/c14-10-2-1-8(5-11(10)15)12-9(6-19-3-4-23-12)7-20-24(21,22)13(16,17)18/h1-2,5,9,12,19-20H,3-4,6-7H2/t9-,12-/m0/s1 |
| InChIKey | HWQQRJSDGPQGKY-CABZTGNLSA-N |
| XLogP | 2.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |