About 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one (PubChem CID 67123420) has the molecular formula C20H15FN6O
and a molecular weight of 374.38 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one.
Molecular Properties
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one |
| PubChem CID | 67123420 |
| Molecular Formula | C20H15FN6O |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one |
| SMILES | C[C@@H](c1ccccc1)n1c(=O)[nH]c2cnc(-c3cnc4ccc(F)cn34)nc21 |
| InChI | InChI=1S/C20H15FN6O/c1-12(13-5-3-2-4-6-13)27-19-15(24-20(27)28)9-23-18(25-19)16-10-22-17-8-7-14(21)11-26(16)17/h2-12H,1H3,(H,24,28)/t12-/m0/s1 |
| InChIKey | JFZIAPFELLCWLF-LBPRGKRZSA-N |
| XLogP | 3.18 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one?
The IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one (CID 67123420) is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one.
What is the SMILES notation for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one?
The canonical SMILES for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one is C[C@@H](c1ccccc1)n1c(=O)[nH]c2cnc(-c3cnc4ccc(F)cn34)nc21.
What is the InChIKey of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one?
The InChIKey is JFZIAPFELLCWLF-LBPRGKRZSA-N. The full InChI is InChI=1S/C20H15FN6O/c1-12(13-5-3-2-4-6-13)27-19-15(24-20(27)28)9-23-18(25-19)16-10-22-17-8-7-14(21)11-26(16)17/h2-12H,1H3,(H,24,28)/t12-/m0/s1.
What are the key properties of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one?
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one has a molecular weight of 374.38 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-[(1S)-1-phenylethyl]-7H-purin-8-one is sourced from PubChem (CID 67123420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).