C32H44N2O14 — CID 6712349
tert-butyl (2R)-3-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]oxy-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 6712349) has the molecular formula C32H44N2O14 and a molecular weight of 680.70 g/mol. Its IUPAC name is tert-butyl (2R)-3-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]oxy-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | tert-butyl (2R)-3-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]oxy-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 6712349 |
| Molecular Formula | C32H44N2O14 |
| Molecular Weight | 680.70 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | tert-butyl (2R)-3-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-(prop-2-enoxycarbonylamino)oxan-2-yl]oxy-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | C=CCOC(=O)NC1C(OC(C)[C@@H](NC(=O)OCc2ccccc2)C(=O)OC(C)(C)C)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C32H44N2O14/c1-9-15-41-30(39)34-25-27(46-21(5)37)26(45-20(4)36)23(17-42-19(3)35)47-29(25)44-18(2)24(28(38)48-32(6,7)8)33-31(40)43-16-22-13-11-10-12-14-22/h9-14,18,23-27,29H,1,15-17H2,2-8H3,(H,33,40)(H,34,39)/t18?,23?,24-,25?,26?,27?,29?/m1/s1 |
| InChIKey | RDURSHAKAIHFIZ-AZQKHBBHSA-N |
| XLogP | 2.46 |
| TPSA | 200.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.70 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|