About [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol
[7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol (PubChem CID 67123902) has the molecular formula C12H15ClFNO2
and a molecular weight of 259.71 g/mol. Its IUPAC name is [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol.
Molecular Properties
| Compound Name | [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol |
| PubChem CID | 67123902 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol |
| SMILES | OCC1(c2ccc(Cl)c(F)c2)CCNCCO1 |
| InChI | InChI=1S/C12H15ClFNO2/c13-10-2-1-9(7-11(10)14)12(8-16)3-4-15-5-6-17-12/h1-2,7,15-16H,3-6,8H2 |
| InChIKey | XGDAICZLBLEDET-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol?
The IUPAC name of [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol (CID 67123902) is [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol.
What is the SMILES notation for [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol?
The canonical SMILES for [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol is OCC1(c2ccc(Cl)c(F)c2)CCNCCO1.
What is the InChIKey of [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol?
The InChIKey is XGDAICZLBLEDET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClFNO2/c13-10-2-1-9(7-11(10)14)12(8-16)3-4-15-5-6-17-12/h1-2,7,15-16H,3-6,8H2.
What are the key properties of [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol?
[7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol has a molecular weight of 259.71 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-7-yl]methanol is sourced from PubChem (CID 67123902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).