About 1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine
1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine (PubChem CID 67124147) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine.
Analyze 1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine?
The IUPAC name of 1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine (CID 67124147) is 1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine.
What is the SMILES notation for 1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine?
The canonical SMILES for 1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine is CCN1CCCC2=C1CN=C2.
What is the InChIKey of 1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine?
The InChIKey is SWBFSVKSRMSPGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-2-11-5-3-4-8-6-10-7-9(8)11/h6H,2-5,7H2,1H3.
What are the key properties of 1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine?
1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine has a molecular weight of 150.22 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,3,4,7-tetrahydropyrrolo[3,4-b]pyridine is sourced from PubChem (CID 67124147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).