C20H16FN7O2 — CID 67124273
N-[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]-5,6,7,8-tetrahydroquinolin-5-amine (PubChem CID 67124273) has the molecular formula C20H16FN7O2 and a molecular weight of 405.39 g/mol. Its IUPAC name is N-[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]-5,6,7,8-tetrahydroquinolin-5-amine.
| Compound Name | N-[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]-5,6,7,8-tetrahydroquinolin-5-amine |
|---|---|
| PubChem CID | 67124273 |
| Molecular Formula | C20H16FN7O2 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]-5,6,7,8-tetrahydroquinolin-5-amine |
| SMILES | O=[N+]([O-])c1cnc(-c2cnc3ccc(F)cn23)nc1NC1CCCc2ncccc21 |
| InChI | InChI=1S/C20H16FN7O2/c21-12-6-7-18-23-9-16(27(18)11-12)19-24-10-17(28(29)30)20(26-19)25-15-5-1-4-14-13(15)3-2-8-22-14/h2-3,6-11,15H,1,4-5H2,(H,24,25,26) |
| InChIKey | LJDRNMACWBAIHF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|