About benzene;1-trimethylsilylethylcarbamic acid
benzene;1-trimethylsilylethylcarbamic acid (PubChem CID 67124326) has the molecular formula C12H21NO2Si
and a molecular weight of 239.39 g/mol. Its IUPAC name is benzene;1-trimethylsilylethylcarbamic acid.
Molecular Properties
| Compound Name | benzene;1-trimethylsilylethylcarbamic acid |
| PubChem CID | 67124326 |
| Molecular Formula | C12H21NO2Si |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | benzene;1-trimethylsilylethylcarbamic acid |
| SMILES | CC(NC(=O)O)[Si](C)(C)C.c1ccccc1 |
| InChI | InChI=1S/C6H15NO2Si.C6H6/c1-5(7-6(8)9)10(2,3)4;1-2-4-6-5-3-1/h5,7H,1-4H3,(H,8,9);1-6H |
| InChIKey | WXQFGVDZNPQQJF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzene;1-trimethylsilylethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1-trimethylsilylethylcarbamic acid?
The IUPAC name of benzene;1-trimethylsilylethylcarbamic acid (CID 67124326) is benzene;1-trimethylsilylethylcarbamic acid.
What is the SMILES notation for benzene;1-trimethylsilylethylcarbamic acid?
The canonical SMILES for benzene;1-trimethylsilylethylcarbamic acid is CC(NC(=O)O)[Si](C)(C)C.c1ccccc1.
What is the InChIKey of benzene;1-trimethylsilylethylcarbamic acid?
The InChIKey is WXQFGVDZNPQQJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2Si.C6H6/c1-5(7-6(8)9)10(2,3)4;1-2-4-6-5-3-1/h5,7H,1-4H3,(H,8,9);1-6H.
What are the key properties of benzene;1-trimethylsilylethylcarbamic acid?
benzene;1-trimethylsilylethylcarbamic acid has a molecular weight of 239.39 g/mol, XLogP of 3.21, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1-trimethylsilylethylcarbamic acid is sourced from PubChem (CID 67124326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).