C14H32OSi2 — CID 67124858
6-(3,3-dimethylbutyl)-2,2,3,3,6-pentamethyloxadisilinane (PubChem CID 67124858) has the molecular formula C14H32OSi2 and a molecular weight of 272.58 g/mol. Its IUPAC name is 6-(3,3-dimethylbutyl)-2,2,3,3,6-pentamethyloxadisilinane.
| Compound Name | 6-(3,3-dimethylbutyl)-2,2,3,3,6-pentamethyloxadisilinane |
|---|---|
| PubChem CID | 67124858 |
| Molecular Formula | C14H32OSi2 |
| Molecular Weight | 272.58 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 6-(3,3-dimethylbutyl)-2,2,3,3,6-pentamethyloxadisilinane |
| SMILES | CC(C)(C)CCC1(C)CC[Si](C)(C)[Si](C)(C)O1 |
| InChI | InChI=1S/C14H32OSi2/c1-13(2,3)9-10-14(4)11-12-16(5,6)17(7,8)15-14/h9-12H2,1-8H3 |
| InChIKey | UWRHGIVJJSYYED-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|