About 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate
2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate (PubChem CID 67125005) has the molecular formula C19H28F4O4
and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate.
Molecular Properties
| Compound Name | 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate |
| PubChem CID | 67125005 |
| Molecular Formula | C19H28F4O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate |
| SMILES | COC1(C(C)(F)CF)C2CC3CC1CC(OCCOC(=O)C(C)(F)F)(C3)C2 |
| InChI | InChI=1S/C19H28F4O4/c1-16(21,11-20)19(25-3)13-6-12-7-14(19)10-18(8-12,9-13)27-5-4-26-15(24)17(2,22)23/h12-14H,4-11H2,1-3H3 |
| InChIKey | JKYDZLDQNWWNAY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate?
The IUPAC name of 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate (CID 67125005) is 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate.
What is the SMILES notation for 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate?
The canonical SMILES for 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate is COC1(C(C)(F)CF)C2CC3CC1CC(OCCOC(=O)C(C)(F)F)(C3)C2.
What is the InChIKey of 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate?
The InChIKey is JKYDZLDQNWWNAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28F4O4/c1-16(21,11-20)19(25-3)13-6-12-7-14(19)10-18(8-12,9-13)27-5-4-26-15(24)17(2,22)23/h12-14H,4-11H2,1-3H3.
What are the key properties of 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate?
2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate has a molecular weight of 396.42 g/mol, XLogP of 3.86, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(1,2-difluoropropan-2-yl)-4-methoxy-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate is sourced from PubChem (CID 67125005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).