C19H24N4O7 — CID 6712508
methyl 2-[[(3aR,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl-phenylmethoxycarbonylamino]acetate (PubChem CID 6712508) has the molecular formula C19H24N4O7 and a molecular weight of 420.42 g/mol. Its IUPAC name is methyl 2-[[(3aR,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl-phenylmethoxycarbonylamino]acetate.
| Compound Name | methyl 2-[[(3aR,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl-phenylmethoxycarbonylamino]acetate |
|---|---|
| PubChem CID | 6712508 |
| Molecular Formula | C19H24N4O7 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | methyl 2-[[(3aR,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl-phenylmethoxycarbonylamino]acetate |
| SMILES | COC(=O)CN(CC1O[C@@H]2OC(C)(C)O[C@@H]2C1N=[N+]=[N-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H24N4O7/c1-19(2)29-16-15(21-22-20)13(28-17(16)30-19)9-23(10-14(24)26-3)18(25)27-11-12-7-5-4-6-8-12/h4-8,13,15-17H,9-11H2,1-3H3/t13?,15?,16-,17-/m1/s1 |
| InChIKey | DDVHEZOWOSXMFL-OKEQZYBDSA-N |
| XLogP | 2.35 |
| TPSA | 132.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|