C12H22N4O2 — CID 67125118
2-methylidene-1,3,8,11-tetrazacyclopentadecane-9,10-dione (PubChem CID 67125118) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-methylidene-1,3,8,11-tetrazacyclopentadecane-9,10-dione.
| Compound Name | 2-methylidene-1,3,8,11-tetrazacyclopentadecane-9,10-dione |
|---|---|
| PubChem CID | 67125118 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-methylidene-1,3,8,11-tetrazacyclopentadecane-9,10-dione |
| SMILES | C=C1NCCCCNC(=O)C(=O)NCCCCN1 |
| InChI | InChI=1S/C12H22N4O2/c1-10-13-6-2-4-8-15-11(17)12(18)16-9-5-3-7-14-10/h13-14H,1-9H2,(H,15,17)(H,16,18) |
| InChIKey | UDWRBYYSEQSPRV-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|