About 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide
2-ethoxythieno[2,3-b]pyrazine-6-carboxamide (PubChem CID 67125564) has the molecular formula C9H9N3O2S
and a molecular weight of 223.26 g/mol. Its IUPAC name is 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide.
Molecular Properties
| Compound Name | 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide |
| PubChem CID | 67125564 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide |
| SMILES | CCOc1cnc2sc(C(N)=O)cc2n1 |
| InChI | InChI=1S/C9H9N3O2S/c1-2-14-7-4-11-9-5(12-7)3-6(15-9)8(10)13/h3-4H,2H2,1H3,(H2,10,13) |
| InChIKey | UJJXPKVEVJBQHW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide?
The IUPAC name of 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide (CID 67125564) is 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide.
What is the SMILES notation for 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide?
The canonical SMILES for 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide is CCOc1cnc2sc(C(N)=O)cc2n1.
What is the InChIKey of 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide?
The InChIKey is UJJXPKVEVJBQHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2S/c1-2-14-7-4-11-9-5(12-7)3-6(15-9)8(10)13/h3-4H,2H2,1H3,(H2,10,13).
What are the key properties of 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide?
2-ethoxythieno[2,3-b]pyrazine-6-carboxamide has a molecular weight of 223.26 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxythieno[2,3-b]pyrazine-6-carboxamide is sourced from PubChem (CID 67125564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).