About 2-(oxetan-3-yl)acetamide
2-(oxetan-3-yl)acetamide (PubChem CID 67125854) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is 2-(oxetan-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(oxetan-3-yl)acetamide |
| PubChem CID | 67125854 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | 2-(oxetan-3-yl)acetamide |
| SMILES | NC(=O)CC1COC1 |
| InChI | InChI=1S/C5H9NO2/c6-5(7)1-4-2-8-3-4/h4H,1-3H2,(H2,6,7) |
| InChIKey | UNBYNGXMMGGSAL-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(oxetan-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxetan-3-yl)acetamide?
The IUPAC name of 2-(oxetan-3-yl)acetamide (CID 67125854) is 2-(oxetan-3-yl)acetamide.
What is the SMILES notation for 2-(oxetan-3-yl)acetamide?
The canonical SMILES for 2-(oxetan-3-yl)acetamide is NC(=O)CC1COC1.
What is the InChIKey of 2-(oxetan-3-yl)acetamide?
The InChIKey is UNBYNGXMMGGSAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2/c6-5(7)1-4-2-8-3-4/h4H,1-3H2,(H2,6,7).
What are the key properties of 2-(oxetan-3-yl)acetamide?
2-(oxetan-3-yl)acetamide has a molecular weight of 115.13 g/mol, XLogP of -0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxetan-3-yl)acetamide is sourced from PubChem (CID 67125854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).