C22H30N4O2 — CID 67125892
N-(4-aminophenyl)-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridine-2-carboxamide (PubChem CID 67125892) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-(4-aminophenyl)-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridine-2-carboxamide.
| Compound Name | N-(4-aminophenyl)-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 67125892 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-(4-aminophenyl)-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypyridine-2-carboxamide |
| SMILES | CN1C(C)(C)CC(Oc2ccc(C(=O)Nc3ccc(N)cc3)nc2)CC1(C)C |
| InChI | InChI=1S/C22H30N4O2/c1-21(2)12-18(13-22(3,4)26(21)5)28-17-10-11-19(24-14-17)20(27)25-16-8-6-15(23)7-9-16/h6-11,14,18H,12-13,23H2,1-5H3,(H,25,27) |
| InChIKey | QWSBDVHJBIZULT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|