C19H22Cl2N2O2 — CID 67125977
tert-butyl N-[(1R,2S)-2-amino-1,2-bis(4-chlorophenyl)ethyl]carbamate (PubChem CID 67125977) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-amino-1,2-bis(4-chlorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-amino-1,2-bis(4-chlorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 67125977 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-amino-1,2-bis(4-chlorophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1ccc(Cl)cc1)[C@@H](N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O2/c1-19(2,3)25-18(24)23-17(13-6-10-15(21)11-7-13)16(22)12-4-8-14(20)9-5-12/h4-11,16-17H,22H2,1-3H3,(H,23,24)/t16-,17+/m0/s1 |
| InChIKey | WIPFVAZZRHSNTE-DLBZAZTESA-N |
| XLogP | 5.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |