C27H32O2S — CID 6712609
2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-5-phenylsulfanylcyclohexa-2,5-diene-1,4-dione (PubChem CID 6712609) has the molecular formula C27H32O2S and a molecular weight of 420.62 g/mol. Its IUPAC name is 2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-5-phenylsulfanylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-5-phenylsulfanylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 6712609 |
| Molecular Formula | C27H32O2S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-5-phenylsulfanylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CCC[C@H]2[C@](C)(CC3=CC(=O)C(Sc4ccccc4)=CC3=O)[C@@H](C)CC[C@]12C |
| InChI | InChI=1S/C27H32O2S/c1-18-9-8-12-25-26(18,3)14-13-19(2)27(25,4)17-20-15-23(29)24(16-22(20)28)30-21-10-6-5-7-11-21/h5-7,9-11,15-16,19,25H,8,12-14,17H2,1-4H3/t19-,25+,26+,27+/m0/s1 |
| InChIKey | NTWJQJYCHGTDBQ-QSFFNLKPSA-N |
| XLogP | 6.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|